C23H21F4NO2 — CID 58111812
(E)-N-[(3-ethynyl-5-fluoro-4-methylphenyl)methyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 58111812) has the molecular formula C23H21F4NO2 and a molecular weight of 419.42 g/mol. Its IUPAC name is (E)-N-[(3-ethynyl-5-fluoro-4-methylphenyl)methyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(3-ethynyl-5-fluoro-4-methylphenyl)methyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 58111812 |
| Molecular Formula | C23H21F4NO2 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (E)-N-[(3-ethynyl-5-fluoro-4-methylphenyl)methyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2OCCC)cc(F)c1C |
| InChI | InChI=1S/C23H21F4NO2/c1-4-10-30-21-13-19(23(25,26)27)8-6-18(21)7-9-22(29)28-14-16-11-17(5-2)15(3)20(24)12-16/h2,6-9,11-13H,4,10,14H2,1,3H3,(H,28,29)/b9-7+ |
| InChIKey | DXKKTLWYJOLHNP-VQHVLOKHSA-N |
| XLogP | 5.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|