C22H22F5NO2 — CID 58111774
(E)-N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 58111774) has the molecular formula C22H22F5NO2 and a molecular weight of 427.41 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 58111774 |
| Molecular Formula | C22H22F5NO2 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (E)-N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCOc1cc(C(F)(F)F)ccc1/C=C/C(=O)N[C@H](C)c1cc(F)c(C)c(F)c1 |
| InChI | InChI=1S/C22H22F5NO2/c1-4-9-30-20-12-17(22(25,26)27)7-5-15(20)6-8-21(29)28-14(3)16-10-18(23)13(2)19(24)11-16/h5-8,10-12,14H,4,9H2,1-3H3,(H,28,29)/b8-6+/t14-/m1/s1 |
| InChIKey | SRHALPZGBYLECI-IZPAUZPXSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|