C22H25F2NO4 — CID 55747210
(E)-3-[2-(difluoromethoxy)phenyl]-N-[1-(3-methoxy-4-propoxyphenyl)ethyl]prop-2-enamide (PubChem CID 55747210) has the molecular formula C22H25F2NO4 and a molecular weight of 405.44 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[1-(3-methoxy-4-propoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[1-(3-methoxy-4-propoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55747210 |
| Molecular Formula | C22H25F2NO4 |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[1-(3-methoxy-4-propoxyphenyl)ethyl]prop-2-enamide |
| SMILES | CCCOc1ccc(C(C)NC(=O)/C=C/c2ccccc2OC(F)F)cc1OC |
| InChI | InChI=1S/C22H25F2NO4/c1-4-13-28-19-11-9-17(14-20(19)27-3)15(2)25-21(26)12-10-16-7-5-6-8-18(16)29-22(23)24/h5-12,14-15,22H,4,13H2,1-3H3,(H,25,26)/b12-10+ |
| InChIKey | YQXORXWPZGZYLS-ZRDIBKRKSA-N |
| XLogP | 4.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|