C22H24F3NO5 — CID 55748515
N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 55748515) has the molecular formula C22H24F3NO5 and a molecular weight of 439.43 g/mol. Its IUPAC name is N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55748515 |
| Molecular Formula | C22H24F3NO5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)C=Cc2ccccc2OC(F)(F)F)cc1OC |
| InChI | InChI=1S/C22H24F3NO5/c1-15(17-8-10-19(20(14-17)29-3)30-13-12-28-2)26-21(27)11-9-16-6-4-5-7-18(16)31-22(23,24)25/h4-11,14-15H,12-13H2,1-3H3,(H,26,27) |
| InChIKey | FJIXECTXOMTZBU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|