C22H21F3N2O3 — CID 46468236
N-[4-[1-[[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]ethyl]phenyl]cyclopropanecarboxamide (PubChem CID 46468236) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is N-[4-[1-[[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]ethyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[1-[[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]ethyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46468236 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[4-[1-[[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]ethyl]phenyl]cyclopropanecarboxamide |
| SMILES | CC(NC(=O)/C=C/c1ccccc1OC(F)(F)F)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C22H21F3N2O3/c1-14(15-8-11-18(12-9-15)27-21(29)17-6-7-17)26-20(28)13-10-16-4-2-3-5-19(16)30-22(23,24)25/h2-5,8-14,17H,6-7H2,1H3,(H,26,28)(H,27,29)/b13-10+ |
| InChIKey | LIEUSJXPRLNCDL-JLHYYAGUSA-N |
| XLogP | 4.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|