C23H26N2O4 — CID 55591052
N-[4-[1-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]ethyl]phenyl]cyclopropanecarboxamide (PubChem CID 55591052) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[4-[1-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]ethyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[1-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]ethyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 55591052 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[4-[1-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]ethyl]phenyl]cyclopropanecarboxamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)NC(C)c2ccc(NC(=O)C3CC3)cc2)c1 |
| InChI | InChI=1S/C23H26N2O4/c1-15(16-6-9-19(10-7-16)25-23(27)17-4-5-17)24-22(26)13-8-18-14-20(28-2)11-12-21(18)29-3/h6-15,17H,4-5H2,1-3H3,(H,24,26)(H,25,27)/b13-8+ |
| InChIKey | CGPUSGPWFTYAFZ-MDWZMJQESA-N |
| XLogP | 3.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|