C20H25F3N2O3 — CID 86962107
N-propan-2-yl-3-[[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]cyclohexane-1-carboxamide (PubChem CID 86962107) has the molecular formula C20H25F3N2O3 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-propan-2-yl-3-[[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-propan-2-yl-3-[[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 86962107 |
| Molecular Formula | C20H25F3N2O3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-propan-2-yl-3-[[(E)-3-[2-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]cyclohexane-1-carboxamide |
| SMILES | CC(C)NC(=O)C1CCCC(NC(=O)/C=C/c2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C20H25F3N2O3/c1-13(2)24-19(27)15-7-5-8-16(12-15)25-18(26)11-10-14-6-3-4-9-17(14)28-20(21,22)23/h3-4,6,9-11,13,15-16H,5,7-8,12H2,1-2H3,(H,24,27)(H,25,26)/b11-10+ |
| InChIKey | LBRVGTMTPLDZJO-ZHACJKMWSA-N |
| XLogP | 3.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|