C21H23F2NO4 — CID 55797709
3-(2,6-difluorophenyl)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]prop-2-enamide (PubChem CID 55797709) has the molecular formula C21H23F2NO4 and a molecular weight of 391.41 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]prop-2-enamide.
| Compound Name | 3-(2,6-difluorophenyl)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55797709 |
| Molecular Formula | C21H23F2NO4 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-(2,6-difluorophenyl)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]prop-2-enamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)C=Cc2c(F)cccc2F)cc1OC |
| InChI | InChI=1S/C21H23F2NO4/c1-14(15-7-9-19(20(13-15)27-3)28-12-11-26-2)24-21(25)10-8-16-17(22)5-4-6-18(16)23/h4-10,13-14H,11-12H2,1-3H3,(H,24,25) |
| InChIKey | JDQFHSCCUIZAEB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|