C21H22F3NO — CID 58111801
(E)-N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-3-(4-fluoro-2-propylphenyl)prop-2-enamide (PubChem CID 58111801) has the molecular formula C21H22F3NO and a molecular weight of 361.41 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-3-(4-fluoro-2-propylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-3-(4-fluoro-2-propylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 58111801 |
| Molecular Formula | C21H22F3NO |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (E)-N-[(1R)-1-(3,5-difluoro-4-methylphenyl)ethyl]-3-(4-fluoro-2-propylphenyl)prop-2-enamide |
| SMILES | CCCc1cc(F)ccc1/C=C/C(=O)N[C@H](C)c1cc(F)c(C)c(F)c1 |
| InChI | InChI=1S/C21H22F3NO/c1-4-5-16-10-18(22)8-6-15(16)7-9-21(26)25-14(3)17-11-19(23)13(2)20(24)12-17/h6-12,14H,4-5H2,1-3H3,(H,25,26)/b9-7+/t14-/m1/s1 |
| InChIKey | XLINPNSLKQHCSX-RCQQVGEISA-N |
| XLogP | 5.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|