C21H23F4N3O3S — CID 68782351
N-[1-[3-fluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 68782351) has the molecular formula C21H23F4N3O3S and a molecular weight of 473.49 g/mol. Its IUPAC name is N-[1-[3-fluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[1-[3-fluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 68782351 |
| Molecular Formula | C21H23F4N3O3S |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[1-[3-fluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | CCCc1nc(C(F)(F)F)ccc1C=CC(=O)NC(C)c1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C21H23F4N3O3S/c1-4-5-17-14(7-10-19(27-17)21(23,24)25)8-11-20(29)26-13(2)15-6-9-18(16(22)12-15)28-32(3,30)31/h6-13,28H,4-5H2,1-3H3,(H,26,29) |
| InChIKey | PMNNWXOYALCRQE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|