C22H26ClF3N4O3S — CID 150282996
3-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[(1R)-1-[3-chloro-4-(methanesulfonamido)phenyl]ethyl]prop-2-enamide (PubChem CID 150282996) has the molecular formula C22H26ClF3N4O3S and a molecular weight of 518.99 g/mol. Its IUPAC name is 3-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[(1R)-1-[3-chloro-4-(methanesulfonamido)phenyl]ethyl]prop-2-enamide.
| Compound Name | 3-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[(1R)-1-[3-chloro-4-(methanesulfonamido)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 150282996 |
| Molecular Formula | C22H26ClF3N4O3S |
| Molecular Weight | 518.99 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 3-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[(1R)-1-[3-chloro-4-(methanesulfonamido)phenyl]ethyl]prop-2-enamide |
| SMILES | CCCCNc1nc(C(F)(F)F)ccc1C=CC(=O)N[C@H](C)c1ccc(NS(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C22H26ClF3N4O3S/c1-4-5-12-27-21-15(7-10-19(29-21)22(24,25)26)8-11-20(31)28-14(2)16-6-9-18(17(23)13-16)30-34(3,32)33/h6-11,13-14,30H,4-5,12H2,1-3H3,(H,27,29)(H,28,31)/t14-/m1/s1 |
| InChIKey | GFZDTGDKDZOGAL-CQSZACIVSA-N |
| XLogP | 5.23 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.99 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|