C23H24F5NO2 — CID 143840703
(E)-3-[2-butan-2-yloxy-4-(trifluoromethyl)phenyl]-N-[1-(3,5-difluorophenyl)propan-2-yl]prop-2-enamide (PubChem CID 143840703) has the molecular formula C23H24F5NO2 and a molecular weight of 441.44 g/mol. Its IUPAC name is (E)-3-[2-butan-2-yloxy-4-(trifluoromethyl)phenyl]-N-[1-(3,5-difluorophenyl)propan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-butan-2-yloxy-4-(trifluoromethyl)phenyl]-N-[1-(3,5-difluorophenyl)propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 143840703 |
| Molecular Formula | C23H24F5NO2 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (E)-3-[2-butan-2-yloxy-4-(trifluoromethyl)phenyl]-N-[1-(3,5-difluorophenyl)propan-2-yl]prop-2-enamide |
| SMILES | CCC(C)Oc1cc(C(F)(F)F)ccc1/C=C/C(=O)NC(C)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H24F5NO2/c1-4-15(3)31-21-12-18(23(26,27)28)7-5-17(21)6-8-22(30)29-14(2)9-16-10-19(24)13-20(25)11-16/h5-8,10-15H,4,9H2,1-3H3,(H,29,30)/b8-6+ |
| InChIKey | KUNXOXQSFYNASE-SOFGYWHQSA-N |
| XLogP | 5.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|