C23H17F4N3O3S2 — CID 74381751
N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-thiophen-3-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 74381751) has the molecular formula C23H17F4N3O3S2 and a molecular weight of 523.53 g/mol. Its IUPAC name is N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-thiophen-3-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-thiophen-3-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 74381751 |
| Molecular Formula | C23H17F4N3O3S2 |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-thiophen-3-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)C=Cc2ccc(C(F)(F)F)nc2-c2ccsc2)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C23H17F4N3O3S2/c1-3-15-10-14(11-18(24)22(15)30-35(2,32)33)12-28-20(31)7-5-16-4-6-19(23(25,26)27)29-21(16)17-8-9-34-13-17/h1,4-11,13,30H,12H2,2H3,(H,28,31) |
| InChIKey | KRDYTZFYJVHNPI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|