C26H24F2N4O3S — CID 173137214
3-[2-(benzylamino)-6-(fluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide (PubChem CID 173137214) has the molecular formula C26H24F2N4O3S and a molecular weight of 510.57 g/mol. Its IUPAC name is 3-[2-(benzylamino)-6-(fluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide.
| Compound Name | 3-[2-(benzylamino)-6-(fluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 173137214 |
| Molecular Formula | C26H24F2N4O3S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 3-[2-(benzylamino)-6-(fluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)C=Cc2ccc(CF)nc2NCc2ccccc2)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C26H24F2N4O3S/c1-3-20-13-19(14-23(28)25(20)32-36(2,34)35)17-29-24(33)12-10-21-9-11-22(15-27)31-26(21)30-16-18-7-5-4-6-8-18/h1,4-14,32H,15-17H2,2H3,(H,29,33)(H,30,31) |
| InChIKey | SSSWHXQRQXAWAU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|