C25H29F2N3O3S — CID 89007630
(E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[6-(fluoromethyl)-2-propyl-3-pyridinyl]hex-2-enamide (PubChem CID 89007630) has the molecular formula C25H29F2N3O3S and a molecular weight of 489.59 g/mol. Its IUPAC name is (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[6-(fluoromethyl)-2-propyl-3-pyridinyl]hex-2-enamide.
| Compound Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[6-(fluoromethyl)-2-propyl-3-pyridinyl]hex-2-enamide |
|---|---|
| PubChem CID | 89007630 |
| Molecular Formula | C25H29F2N3O3S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[6-(fluoromethyl)-2-propyl-3-pyridinyl]hex-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)/C=C(\CCC)c2ccc(CF)nc2CCC)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C25H29F2N3O3S/c1-5-8-19(21-11-10-20(15-26)29-23(21)9-6-2)14-24(31)28-16-17-12-18(7-3)25(22(27)13-17)30-34(4,32)33/h3,10-14,30H,5-6,8-9,15-16H2,1-2,4H3,(H,28,31)/b19-14+ |
| InChIKey | ZBCRZVHJNYVQEX-XMHGGMMESA-N |
| XLogP | 4.50 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|