C21H21F4N5O4S — CID 68781726
(Z)-N-[[3-cyano-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(2-methoxyethylamino)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 68781726) has the molecular formula C21H21F4N5O4S and a molecular weight of 515.49 g/mol. Its IUPAC name is (Z)-N-[[3-cyano-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(2-methoxyethylamino)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (Z)-N-[[3-cyano-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(2-methoxyethylamino)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 68781726 |
| Molecular Formula | C21H21F4N5O4S |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | (Z)-N-[[3-cyano-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(2-methoxyethylamino)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | COCCNc1nc(C(F)(F)F)ccc1/C=C\C(=O)NCc1cc(F)c(NS(C)(=O)=O)c(C#N)c1 |
| InChI | InChI=1S/C21H21F4N5O4S/c1-34-8-7-27-20-14(3-5-17(29-20)21(23,24)25)4-6-18(31)28-12-13-9-15(11-26)19(16(22)10-13)30-35(2,32)33/h3-6,9-10,30H,7-8,12H2,1-2H3,(H,27,29)(H,28,31)/b6-4- |
| InChIKey | VGRFOIOCWRVEBC-XQRVVYSFSA-N |
| XLogP | 2.87 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|