C21H23F4N3O4S — CID 59598287
(E)-3-[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide (PubChem CID 59598287) has the molecular formula C21H23F4N3O4S and a molecular weight of 489.49 g/mol. Its IUPAC name is (E)-3-[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 59598287 |
| Molecular Formula | C21H23F4N3O4S |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | (E)-3-[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
| SMILES | CCCCOc1nc(C(F)(F)F)ccc1/C=C/C(=O)NCc1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C21H23F4N3O4S/c1-3-4-11-32-20-15(6-9-18(27-20)21(23,24)25)7-10-19(29)26-13-14-5-8-17(16(22)12-14)28-33(2,30)31/h5-10,12,28H,3-4,11,13H2,1-2H3,(H,26,29)/b10-7+ |
| InChIKey | OXSLEZGZYJOUJS-JXMROGBWSA-N |
| XLogP | 4.12 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|