C21H24F3N3O3S — CID 68780420
N-[[4-(methanesulfonamido)-3-methylphenyl]methyl]-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 68780420) has the molecular formula C21H24F3N3O3S and a molecular weight of 455.50 g/mol. Its IUPAC name is N-[[4-(methanesulfonamido)-3-methylphenyl]methyl]-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[[4-(methanesulfonamido)-3-methylphenyl]methyl]-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 68780420 |
| Molecular Formula | C21H24F3N3O3S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[[4-(methanesulfonamido)-3-methylphenyl]methyl]-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | CCCc1nc(C(F)(F)F)ccc1C=CC(=O)NCc1ccc(NS(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C21H24F3N3O3S/c1-4-5-18-16(7-10-19(26-18)21(22,23)24)8-11-20(28)25-13-15-6-9-17(14(2)12-15)27-31(3,29)30/h6-12,27H,4-5,13H2,1-3H3,(H,25,28) |
| InChIKey | WMRAXHSBCBVPPZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|