C23H20F4N4O3S — CID 59598256
(E)-3-[2-anilino-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide (PubChem CID 59598256) has the molecular formula C23H20F4N4O3S and a molecular weight of 508.50 g/mol. Its IUPAC name is (E)-3-[2-anilino-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-anilino-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 59598256 |
| Molecular Formula | C23H20F4N4O3S |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (E)-3-[2-anilino-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
| SMILES | CS(=O)(=O)Nc1ccc(CNC(=O)/C=C/c2ccc(C(F)(F)F)nc2Nc2ccccc2)cc1F |
| InChI | InChI=1S/C23H20F4N4O3S/c1-35(33,34)31-19-10-7-15(13-18(19)24)14-28-21(32)12-9-16-8-11-20(23(25,26)27)30-22(16)29-17-5-3-2-4-6-17/h2-13,31H,14H2,1H3,(H,28,32)(H,29,30)/b12-9+ |
| InChIKey | FHPNDQWRYNVVRX-FMIVXFBMSA-N |
| XLogP | 4.68 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|