C21H24F3N3O3S — CID 66856177
(E)-3-[2-(butylamino)-4-fluorophenyl]-N-[[3,5-difluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide (PubChem CID 66856177) has the molecular formula C21H24F3N3O3S and a molecular weight of 455.50 g/mol. Its IUPAC name is (E)-3-[2-(butylamino)-4-fluorophenyl]-N-[[3,5-difluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(butylamino)-4-fluorophenyl]-N-[[3,5-difluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 66856177 |
| Molecular Formula | C21H24F3N3O3S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (E)-3-[2-(butylamino)-4-fluorophenyl]-N-[[3,5-difluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
| SMILES | CCCCNc1cc(F)ccc1/C=C/C(=O)NCc1cc(F)c(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C21H24F3N3O3S/c1-3-4-9-25-19-12-16(22)7-5-15(19)6-8-20(28)26-13-14-10-17(23)21(18(24)11-14)27-31(2,29)30/h5-8,10-12,25,27H,3-4,9,13H2,1-2H3,(H,26,28)/b8-6+ |
| InChIKey | BEFVJUGKRISSCN-SOFGYWHQSA-N |
| XLogP | 4.02 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|