C21H21FN2O3S — CID 57391194
2-[3-fluoro-4-(methanesulfonamido)phenyl]-N-(naphthalen-2-ylmethyl)propanamide (PubChem CID 57391194) has the molecular formula C21H21FN2O3S and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[3-fluoro-4-(methanesulfonamido)phenyl]-N-(naphthalen-2-ylmethyl)propanamide.
| Compound Name | 2-[3-fluoro-4-(methanesulfonamido)phenyl]-N-(naphthalen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 57391194 |
| Molecular Formula | C21H21FN2O3S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-[3-fluoro-4-(methanesulfonamido)phenyl]-N-(naphthalen-2-ylmethyl)propanamide |
| SMILES | CC(C(=O)NCc1ccc2ccccc2c1)c1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C21H21FN2O3S/c1-14(17-9-10-20(19(22)12-17)24-28(2,26)27)21(25)23-13-15-7-8-16-5-3-4-6-18(16)11-15/h3-12,14,24H,13H2,1-2H3,(H,23,25) |
| InChIKey | OGHRHBJWRKPAEH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |