C17H15Br2F4N3O3S — CID 87840143
N-[[2,4-dibromo-6-(trifluoromethyl)-3-pyridinyl]methyl]-2-[3-fluoro-4-(methanesulfonamido)phenyl]propanamide (PubChem CID 87840143) has the molecular formula C17H15Br2F4N3O3S and a molecular weight of 577.19 g/mol. Its IUPAC name is N-[[2,4-dibromo-6-(trifluoromethyl)-3-pyridinyl]methyl]-2-[3-fluoro-4-(methanesulfonamido)phenyl]propanamide.
| Compound Name | N-[[2,4-dibromo-6-(trifluoromethyl)-3-pyridinyl]methyl]-2-[3-fluoro-4-(methanesulfonamido)phenyl]propanamide |
|---|---|
| PubChem CID | 87840143 |
| Molecular Formula | C17H15Br2F4N3O3S |
| Molecular Weight | 577.19 g/mol |
| Exact Mass | 574.91 |
| IUPAC Name | N-[[2,4-dibromo-6-(trifluoromethyl)-3-pyridinyl]methyl]-2-[3-fluoro-4-(methanesulfonamido)phenyl]propanamide |
| SMILES | CC(C(=O)NCc1c(Br)cc(C(F)(F)F)nc1Br)c1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C17H15Br2F4N3O3S/c1-8(9-3-4-13(12(20)5-9)26-30(2,28)29)16(27)24-7-10-11(18)6-14(17(21,22)23)25-15(10)19/h3-6,8,26H,7H2,1-2H3,(H,24,27) |
| InChIKey | OVVJUYJGSXLUSQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.19 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|