C17H16F5N3O3S — CID 25063518
2-[3-fluoro-4-(methanesulfonamido)phenyl]-N-[[2-fluoro-6-(trifluoromethyl)-3-pyridinyl]methyl]propanamide (PubChem CID 25063518) has the molecular formula C17H16F5N3O3S and a molecular weight of 437.39 g/mol. Its IUPAC name is 2-[3-fluoro-4-(methanesulfonamido)phenyl]-N-[[2-fluoro-6-(trifluoromethyl)-3-pyridinyl]methyl]propanamide.
| Compound Name | 2-[3-fluoro-4-(methanesulfonamido)phenyl]-N-[[2-fluoro-6-(trifluoromethyl)-3-pyridinyl]methyl]propanamide |
|---|---|
| PubChem CID | 25063518 |
| Molecular Formula | C17H16F5N3O3S |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-[3-fluoro-4-(methanesulfonamido)phenyl]-N-[[2-fluoro-6-(trifluoromethyl)-3-pyridinyl]methyl]propanamide |
| SMILES | CC(C(=O)NCc1ccc(C(F)(F)F)nc1F)c1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C17H16F5N3O3S/c1-9(10-3-5-13(12(18)7-10)25-29(2,27)28)16(26)23-8-11-4-6-14(17(20,21)22)24-15(11)19/h3-7,9,25H,8H2,1-2H3,(H,23,26) |
| InChIKey | SKIYVKOGZDKUBG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|