C17H20N2S2 — CID 3783893
1-[(4-methylsulfanylphenyl)methyl]-3-(2-phenylethyl)thiourea (PubChem CID 3783893) has the molecular formula C17H20N2S2 and a molecular weight of 316.50 g/mol. Its IUPAC name is 1-[(4-methylsulfanylphenyl)methyl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[(4-methylsulfanylphenyl)methyl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3783893 |
| Molecular Formula | C17H20N2S2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-[(4-methylsulfanylphenyl)methyl]-3-(2-phenylethyl)thiourea |
| SMILES | CSc1ccc(CNC(=S)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2S2/c1-21-16-9-7-15(8-10-16)13-19-17(20)18-12-11-14-5-3-2-4-6-14/h2-10H,11-13H2,1H3,(H2,18,19,20) |
| InChIKey | MSAZUJZDDVEVCB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|