C17H19FN2S — CID 3748869
1-[(5-fluoro-2-methylphenyl)methyl]-3-(2-phenylethyl)thiourea (PubChem CID 3748869) has the molecular formula C17H19FN2S and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methylphenyl)methyl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[(5-fluoro-2-methylphenyl)methyl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3748869 |
| Molecular Formula | C17H19FN2S |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[(5-fluoro-2-methylphenyl)methyl]-3-(2-phenylethyl)thiourea |
| SMILES | Cc1ccc(F)cc1CNC(=S)NCCc1ccccc1 |
| InChI | InChI=1S/C17H19FN2S/c1-13-7-8-16(18)11-15(13)12-20-17(21)19-10-9-14-5-3-2-4-6-14/h2-8,11H,9-10,12H2,1H3,(H2,19,20,21) |
| InChIKey | KWEJCUNBJMMGSM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|