C26H44FN3O3S2 — CID 11670977
1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[(E)-11-hydroxyheptadec-8-enyl]thiourea (PubChem CID 11670977) has the molecular formula C26H44FN3O3S2 and a molecular weight of 529.79 g/mol. Its IUPAC name is 1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[(E)-11-hydroxyheptadec-8-enyl]thiourea.
| Compound Name | 1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[(E)-11-hydroxyheptadec-8-enyl]thiourea |
|---|---|
| PubChem CID | 11670977 |
| Molecular Formula | C26H44FN3O3S2 |
| Molecular Weight | 529.79 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[(E)-11-hydroxyheptadec-8-enyl]thiourea |
| SMILES | CCCCCCC(O)C/C=C/CCCCCCCNC(=S)NCc1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C26H44FN3O3S2/c1-3-4-5-12-15-23(31)16-13-10-8-6-7-9-11-14-19-28-26(34)29-21-22-17-18-25(24(27)20-22)30-35(2,32)33/h10,13,17-18,20,23,30-31H,3-9,11-12,14-16,19,21H2,1-2H3,(H2,28,29,34)/b13-10+ |
| InChIKey | BFAOFIYRPOBIDK-JLHYYAGUSA-N |
| XLogP | 5.78 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.79 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|