C27H39ClN2OS — CID 23815443
1-[(3-chloro-4-hydroxyphenyl)methyl]-3-[(4Z,7E,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]thiourea (PubChem CID 23815443) has the molecular formula C27H39ClN2OS and a molecular weight of 475.14 g/mol. Its IUPAC name is 1-[(3-chloro-4-hydroxyphenyl)methyl]-3-[(4Z,7E,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]thiourea.
| Compound Name | 1-[(3-chloro-4-hydroxyphenyl)methyl]-3-[(4Z,7E,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]thiourea |
|---|---|
| PubChem CID | 23815443 |
| Molecular Formula | C27H39ClN2OS |
| Molecular Weight | 475.14 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 1-[(3-chloro-4-hydroxyphenyl)methyl]-3-[(4Z,7E,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]thiourea |
| SMILES | CCCCC/C=C\C/C=C\C/C=C/C/C=C\CCCNC(=S)NCc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C27H39ClN2OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-29-27(32)30-23-24-19-20-26(31)25(28)22-24/h6-7,9-10,12-13,15-16,19-20,22,31H,2-5,8,11,14,17-18,21,23H2,1H3,(H2,29,30,32)/b7-6-,10-9-,13-12+,16-15- |
| InChIKey | YJDJXJVMJOMZOH-AVHBIOJASA-N |
| XLogP | 7.77 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.14 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|