C18H29BrN4S2 — CID 10527312
1-[[3-bromo-5-[(butylcarbamothioylamino)methyl]phenyl]methyl]-3-butylthiourea (PubChem CID 10527312) has the molecular formula C18H29BrN4S2 and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-[[3-bromo-5-[(butylcarbamothioylamino)methyl]phenyl]methyl]-3-butylthiourea.
| Compound Name | 1-[[3-bromo-5-[(butylcarbamothioylamino)methyl]phenyl]methyl]-3-butylthiourea |
|---|---|
| PubChem CID | 10527312 |
| Molecular Formula | C18H29BrN4S2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-[[3-bromo-5-[(butylcarbamothioylamino)methyl]phenyl]methyl]-3-butylthiourea |
| SMILES | CCCCNC(=S)NCc1cc(Br)cc(CNC(=S)NCCCC)c1 |
| InChI | InChI=1S/C18H29BrN4S2/c1-3-5-7-20-17(24)22-12-14-9-15(11-16(19)10-14)13-23-18(25)21-8-6-4-2/h9-11H,3-8,12-13H2,1-2H3,(H2,20,22,24)(H2,21,23,25) |
| InChIKey | MQJRCXFWNBDRRS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|