C23H33N3O4S2 — CID 87702113
1-[[4-(methanesulfonamido)phenyl]methyl]-3-[[4-(2-methoxy-3,3-dimethylbutoxy)phenyl]methyl]thiourea (PubChem CID 87702113) has the molecular formula C23H33N3O4S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 1-[[4-(methanesulfonamido)phenyl]methyl]-3-[[4-(2-methoxy-3,3-dimethylbutoxy)phenyl]methyl]thiourea.
| Compound Name | 1-[[4-(methanesulfonamido)phenyl]methyl]-3-[[4-(2-methoxy-3,3-dimethylbutoxy)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 87702113 |
| Molecular Formula | C23H33N3O4S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 1-[[4-(methanesulfonamido)phenyl]methyl]-3-[[4-(2-methoxy-3,3-dimethylbutoxy)phenyl]methyl]thiourea |
| SMILES | COC(COc1ccc(CNC(=S)NCc2ccc(NS(C)(=O)=O)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C23H33N3O4S2/c1-23(2,3)21(29-4)16-30-20-12-8-18(9-13-20)15-25-22(31)24-14-17-6-10-19(11-7-17)26-32(5,27)28/h6-13,21,26H,14-16H2,1-5H3,(H2,24,25,31) |
| InChIKey | XQZRVGTVBYDYLX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|