C20H27N3O3S2 — CID 91516144
1-[(4-tert-butylphenyl)methyl]-3-[[4-(methanesulfonamido)phenyl]methyl]-1-sulfanylurea (PubChem CID 91516144) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3-[[4-(methanesulfonamido)phenyl]methyl]-1-sulfanylurea.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3-[[4-(methanesulfonamido)phenyl]methyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 91516144 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3-[[4-(methanesulfonamido)phenyl]methyl]-1-sulfanylurea |
| SMILES | CC(C)(C)c1ccc(CN(S)C(=O)NCc2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-20(2,3)17-9-5-16(6-10-17)14-23(27)19(24)21-13-15-7-11-18(12-8-15)22-28(4,25)26/h5-12,22,27H,13-14H2,1-4H3,(H,21,24) |
| InChIKey | FOBGJGUJSANSCW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|