C16H26N2O3S — CID 71998790
N-[(4-tert-butylphenyl)methyl]-2-(methanesulfonamido)-2-methylpropanamide (PubChem CID 71998790) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2-(methanesulfonamido)-2-methylpropanamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2-(methanesulfonamido)-2-methylpropanamide |
|---|---|
| PubChem CID | 71998790 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2-(methanesulfonamido)-2-methylpropanamide |
| SMILES | CC(C)(NS(C)(=O)=O)C(=O)NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-15(2,3)13-9-7-12(8-10-13)11-17-14(19)16(4,5)18-22(6,20)21/h7-10,18H,11H2,1-6H3,(H,17,19) |
| InChIKey | MNRPYNRHWHXXMH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |