C25H34O9S3 — CID 91314027
methanesulfonic acid;1-methyl-4-[4-[2-(4-methylphenyl)ethyl]phenyl]benzene (PubChem CID 91314027) has the molecular formula C25H34O9S3 and a molecular weight of 574.74 g/mol. Its IUPAC name is methanesulfonic acid;1-methyl-4-[4-[2-(4-methylphenyl)ethyl]phenyl]benzene.
| Compound Name | methanesulfonic acid;1-methyl-4-[4-[2-(4-methylphenyl)ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 91314027 |
| Molecular Formula | C25H34O9S3 |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | methanesulfonic acid;1-methyl-4-[4-[2-(4-methylphenyl)ethyl]phenyl]benzene |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.CS(=O)(=O)O.Cc1ccc(CCc2ccc(-c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H22.3CH4O3S/c1-17-3-7-19(8-4-17)9-10-20-11-15-22(16-12-20)21-13-5-18(2)6-14-21;3*1-5(2,3)4/h3-8,11-16H,9-10H2,1-2H3;3*1H3,(H,2,3,4) |
| InChIKey | XEXPBKFLXXDHQM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|