C10H15NO3S — CID 175464226
1-amino-3-(4-methylphenyl)propane-1-sulfonic acid (PubChem CID 175464226) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-amino-3-(4-methylphenyl)propane-1-sulfonic acid.
| Compound Name | 1-amino-3-(4-methylphenyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175464226 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 1-amino-3-(4-methylphenyl)propane-1-sulfonic acid |
| SMILES | Cc1ccc(CCC(N)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H15NO3S/c1-8-2-4-9(5-3-8)6-7-10(11)15(12,13)14/h2-5,10H,6-7,11H2,1H3,(H,12,13,14) |
| InChIKey | CWHJJQFPLUXFOV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|