C10H12F2 — CID 142361339
1-(3,3-difluoropropyl)-4-methylbenzene (PubChem CID 142361339) has the molecular formula C10H12F2 and a molecular weight of 170.20 g/mol. Its IUPAC name is 1-(3,3-difluoropropyl)-4-methylbenzene.
| Compound Name | 1-(3,3-difluoropropyl)-4-methylbenzene |
|---|---|
| PubChem CID | 142361339 |
| Molecular Formula | C10H12F2 |
| Molecular Weight | 170.20 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-(3,3-difluoropropyl)-4-methylbenzene |
| SMILES | Cc1ccc(CCC(F)F)cc1 |
| InChI | InChI=1S/C10H12F2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2-5,10H,6-7H2,1H3 |
| InChIKey | BMVKLIOCCXSDQO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |