About 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene
2-bromobutane;1-(3-bromobutyl)-4-methylbenzene (PubChem CID 160913632) has the molecular formula C15H24Br2
and a molecular weight of 364.17 g/mol. Its IUPAC name is 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene.
Molecular Properties
| Compound Name | 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene |
| PubChem CID | 160913632 |
| Molecular Formula | C15H24Br2 |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene |
| SMILES | CCC(C)Br.Cc1ccc(CCC(C)Br)cc1 |
| InChI | InChI=1S/C11H15Br.C4H9Br/c1-9-3-6-11(7-4-9)8-5-10(2)12;1-3-4(2)5/h3-4,6-7,10H,5,8H2,1-2H3;4H,3H2,1-2H3 |
| InChIKey | SRCPYRBUOWOCKF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene?
The IUPAC name of 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene (CID 160913632) is 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene.
What is the SMILES notation for 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene?
The canonical SMILES for 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene is CCC(C)Br.Cc1ccc(CCC(C)Br)cc1.
What is the InChIKey of 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene?
The InChIKey is SRCPYRBUOWOCKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Br.C4H9Br/c1-9-3-6-11(7-4-9)8-5-10(2)12;1-3-4(2)5/h3-4,6-7,10H,5,8H2,1-2H3;4H,3H2,1-2H3.
What are the key properties of 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene?
2-bromobutane;1-(3-bromobutyl)-4-methylbenzene has a molecular weight of 364.17 g/mol, XLogP of 5.89, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobutane;1-(3-bromobutyl)-4-methylbenzene is sourced from PubChem (CID 160913632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).