C14H20Br2 — CID 95239997
1,4-bis[(3S)-3-bromobutyl]benzene (PubChem CID 95239997) has the molecular formula C14H20Br2 and a molecular weight of 348.12 g/mol. Its IUPAC name is 1,4-bis[(3S)-3-bromobutyl]benzene.
| Compound Name | 1,4-bis[(3S)-3-bromobutyl]benzene |
|---|---|
| PubChem CID | 95239997 |
| Molecular Formula | C14H20Br2 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 1,4-bis[(3S)-3-bromobutyl]benzene |
| SMILES | C[C@H](Br)CCc1ccc(CC[C@H](C)Br)cc1 |
| InChI | InChI=1S/C14H20Br2/c1-11(15)3-5-13-7-9-14(10-8-13)6-4-12(2)16/h7-12H,3-6H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | QFWLVUKMXQHLHF-RYUDHWBXSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|