C6H9BrN2S — CID 130856064
3-(3-bromobutyl)-1,2,5-thiadiazole (PubChem CID 130856064) has the molecular formula C6H9BrN2S and a molecular weight of 221.12 g/mol. Its IUPAC name is 3-(3-bromobutyl)-1,2,5-thiadiazole.
| Compound Name | 3-(3-bromobutyl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 130856064 |
| Molecular Formula | C6H9BrN2S |
| Molecular Weight | 221.12 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 3-(3-bromobutyl)-1,2,5-thiadiazole |
| SMILES | CC(Br)CCc1cnsn1 |
| InChI | InChI=1S/C6H9BrN2S/c1-5(7)2-3-6-4-8-10-9-6/h4-5H,2-3H2,1H3 |
| InChIKey | RYIUEVTWPZGTKI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.12 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|