C5H6N2O2S — CID 130815190
2-hydroxy-3-(1,2,5-thiadiazol-3-yl)propanal (PubChem CID 130815190) has the molecular formula C5H6N2O2S and a molecular weight of 158.18 g/mol. Its IUPAC name is 2-hydroxy-3-(1,2,5-thiadiazol-3-yl)propanal.
| Compound Name | 2-hydroxy-3-(1,2,5-thiadiazol-3-yl)propanal |
|---|---|
| PubChem CID | 130815190 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 2-hydroxy-3-(1,2,5-thiadiazol-3-yl)propanal |
| SMILES | O=CC(O)Cc1cnsn1 |
| InChI | InChI=1S/C5H6N2O2S/c8-3-5(9)1-4-2-6-10-7-4/h2-3,5,9H,1H2 |
| InChIKey | MAVVMBBFXQPSOM-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|