C8H12N2OS2 — CID 130815238
2-(1,2,5-thiadiazol-3-yl)-1-(thiolan-3-yl)ethanol (PubChem CID 130815238) has the molecular formula C8H12N2OS2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(1,2,5-thiadiazol-3-yl)-1-(thiolan-3-yl)ethanol.
| Compound Name | 2-(1,2,5-thiadiazol-3-yl)-1-(thiolan-3-yl)ethanol |
|---|---|
| PubChem CID | 130815238 |
| Molecular Formula | C8H12N2OS2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 2-(1,2,5-thiadiazol-3-yl)-1-(thiolan-3-yl)ethanol |
| SMILES | OC(Cc1cnsn1)C1CCSC1 |
| InChI | InChI=1S/C8H12N2OS2/c11-8(6-1-2-12-5-6)3-7-4-9-13-10-7/h4,6,8,11H,1-3,5H2 |
| InChIKey | QMMNBTZPLASTOI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |