C10H14N2OS — CID 130815266
1-cyclohex-3-en-1-yl-2-(1,2,5-thiadiazol-3-yl)ethanol (PubChem CID 130815266) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-yl-2-(1,2,5-thiadiazol-3-yl)ethanol.
| Compound Name | 1-cyclohex-3-en-1-yl-2-(1,2,5-thiadiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 130815266 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-cyclohex-3-en-1-yl-2-(1,2,5-thiadiazol-3-yl)ethanol |
| SMILES | OC(Cc1cnsn1)C1CC=CCC1 |
| InChI | InChI=1S/C10H14N2OS/c13-10(6-9-7-11-14-12-9)8-4-2-1-3-5-8/h1-2,7-8,10,13H,3-6H2 |
| InChIKey | UKTYLYPBEQPONH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|