C8H13N3OS — CID 164650172
1-pyrrolidin-3-yl-2-(1,2,5-thiadiazol-3-yl)ethanol (PubChem CID 164650172) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-pyrrolidin-3-yl-2-(1,2,5-thiadiazol-3-yl)ethanol.
| Compound Name | 1-pyrrolidin-3-yl-2-(1,2,5-thiadiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 164650172 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-pyrrolidin-3-yl-2-(1,2,5-thiadiazol-3-yl)ethanol |
| SMILES | OC(Cc1cnsn1)C1CCNC1 |
| InChI | InChI=1S/C8H13N3OS/c12-8(6-1-2-9-4-6)3-7-5-10-13-11-7/h5-6,8-9,12H,1-4H2 |
| InChIKey | NTMZSEBAKYOXDA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |