C14H16BrFO — CID 65149611
2-(5-bromo-2-fluorophenyl)-1-cyclohex-3-en-1-ylethanol (PubChem CID 65149611) has the molecular formula C14H16BrFO and a molecular weight of 299.18 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-1-cyclohex-3-en-1-ylethanol.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-1-cyclohex-3-en-1-ylethanol |
|---|---|
| PubChem CID | 65149611 |
| Molecular Formula | C14H16BrFO |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-1-cyclohex-3-en-1-ylethanol |
| SMILES | OC(Cc1cc(Br)ccc1F)C1CC=CCC1 |
| InChI | InChI=1S/C14H16BrFO/c15-12-6-7-13(16)11(8-12)9-14(17)10-4-2-1-3-5-10/h1-2,6-8,10,14,17H,3-5,9H2 |
| InChIKey | OIFGXCDCMMHJOD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|