C13H17BrFN — CID 62528286
N-[3-(5-bromo-2-fluorophenyl)-2-methylpropyl]cyclopropanamine (PubChem CID 62528286) has the molecular formula C13H17BrFN and a molecular weight of 286.19 g/mol. Its IUPAC name is N-[3-(5-bromo-2-fluorophenyl)-2-methylpropyl]cyclopropanamine.
| Compound Name | N-[3-(5-bromo-2-fluorophenyl)-2-methylpropyl]cyclopropanamine |
|---|---|
| PubChem CID | 62528286 |
| Molecular Formula | C13H17BrFN |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-[3-(5-bromo-2-fluorophenyl)-2-methylpropyl]cyclopropanamine |
| SMILES | CC(CNC1CC1)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H17BrFN/c1-9(8-16-12-3-4-12)6-10-7-11(14)2-5-13(10)15/h2,5,7,9,12,16H,3-4,6,8H2,1H3 |
| InChIKey | LUFFHSDSIDAVFP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |