C8H7ClN2O2S — CID 130815155
1-(5-chlorofuran-2-yl)-2-(1,2,5-thiadiazol-3-yl)ethanol (PubChem CID 130815155) has the molecular formula C8H7ClN2O2S and a molecular weight of 230.68 g/mol. Its IUPAC name is 1-(5-chlorofuran-2-yl)-2-(1,2,5-thiadiazol-3-yl)ethanol.
| Compound Name | 1-(5-chlorofuran-2-yl)-2-(1,2,5-thiadiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 130815155 |
| Molecular Formula | C8H7ClN2O2S |
| Molecular Weight | 230.68 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 1-(5-chlorofuran-2-yl)-2-(1,2,5-thiadiazol-3-yl)ethanol |
| SMILES | OC(Cc1cnsn1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C8H7ClN2O2S/c9-8-2-1-7(13-8)6(12)3-5-4-10-14-11-5/h1-2,4,6,12H,3H2 |
| InChIKey | ATEYNPWGKBBLIN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |