C20H26O2 — CID 130315848
2-[2-[4-[2-(4-methylphenyl)ethyl]phenyl]ethyl]propane-1,3-diol (PubChem CID 130315848) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[2-[4-[2-(4-methylphenyl)ethyl]phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-[2-[4-[2-(4-methylphenyl)ethyl]phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 130315848 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[2-[4-[2-(4-methylphenyl)ethyl]phenyl]ethyl]propane-1,3-diol |
| SMILES | Cc1ccc(CCc2ccc(CCC(CO)CO)cc2)cc1 |
| InChI | InChI=1S/C20H26O2/c1-16-2-4-17(5-3-16)6-7-18-8-10-19(11-9-18)12-13-20(14-21)15-22/h2-5,8-11,20-22H,6-7,12-15H2,1H3 |
| InChIKey | KPSFTHNQRJEWEI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |