C17H19FO2 — CID 145126379
2-[2-[4-(2-fluorophenyl)phenyl]ethyl]propane-1,3-diol (PubChem CID 145126379) has the molecular formula C17H19FO2 and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-[2-[4-(2-fluorophenyl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-[2-[4-(2-fluorophenyl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 145126379 |
| Molecular Formula | C17H19FO2 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[2-[4-(2-fluorophenyl)phenyl]ethyl]propane-1,3-diol |
| SMILES | OCC(CO)CCc1ccc(-c2ccccc2F)cc1 |
| InChI | InChI=1S/C17H19FO2/c18-17-4-2-1-3-16(17)15-9-7-13(8-10-15)5-6-14(11-19)12-20/h1-4,7-10,14,19-20H,5-6,11-12H2 |
| InChIKey | VODNOPDURKPMAN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |