C14H23NO2 — CID 97323021
2-[[(2S)-4-(4-methylphenyl)butan-2-yl]amino]propane-1,3-diol (PubChem CID 97323021) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 2-[[(2S)-4-(4-methylphenyl)butan-2-yl]amino]propane-1,3-diol.
| Compound Name | 2-[[(2S)-4-(4-methylphenyl)butan-2-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 97323021 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2-[[(2S)-4-(4-methylphenyl)butan-2-yl]amino]propane-1,3-diol |
| SMILES | Cc1ccc(CC[C@H](C)NC(CO)CO)cc1 |
| InChI | InChI=1S/C14H23NO2/c1-11-3-6-13(7-4-11)8-5-12(2)15-14(9-16)10-17/h3-4,6-7,12,14-17H,5,8-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | YCYBKWDXSPOBNY-LBPRGKRZSA-N |
| XLogP | 1.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |