C17H27F2NO2 — CID 119165159
2-[4-[4-(difluoromethoxy)phenyl]butan-2-ylamino]-4-methylpentan-1-ol (PubChem CID 119165159) has the molecular formula C17H27F2NO2 and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)phenyl]butan-2-ylamino]-4-methylpentan-1-ol.
| Compound Name | 2-[4-[4-(difluoromethoxy)phenyl]butan-2-ylamino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 119165159 |
| Molecular Formula | C17H27F2NO2 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)phenyl]butan-2-ylamino]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)NC(C)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H27F2NO2/c1-12(2)10-15(11-21)20-13(3)4-5-14-6-8-16(9-7-14)22-17(18)19/h6-9,12-13,15,17,20-21H,4-5,10-11H2,1-3H3 |
| InChIKey | YFZFCIJPMJDGGB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |