C12H18O4S — CID 83926331
2-[2-(4-methylsulfonylphenyl)ethyl]propane-1,3-diol (PubChem CID 83926331) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-[2-(4-methylsulfonylphenyl)ethyl]propane-1,3-diol.
| Compound Name | 2-[2-(4-methylsulfonylphenyl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 83926331 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-[2-(4-methylsulfonylphenyl)ethyl]propane-1,3-diol |
| SMILES | CS(=O)(=O)c1ccc(CCC(CO)CO)cc1 |
| InChI | InChI=1S/C12H18O4S/c1-17(15,16)12-6-4-10(5-7-12)2-3-11(8-13)9-14/h4-7,11,13-14H,2-3,8-9H2,1H3 |
| InChIKey | CAJSSUOSFHJHCZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |