C13H20O4S — CID 83926391
1-(4-methylsulfonylphenyl)hexane-3,4-diol (PubChem CID 83926391) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)hexane-3,4-diol.
| Compound Name | 1-(4-methylsulfonylphenyl)hexane-3,4-diol |
|---|---|
| PubChem CID | 83926391 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)hexane-3,4-diol |
| SMILES | CCC(O)C(O)CCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H20O4S/c1-3-12(14)13(15)9-6-10-4-7-11(8-5-10)18(2,16)17/h4-5,7-8,12-15H,3,6,9H2,1-2H3 |
| InChIKey | YZVJOTOSJXUIDZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |